C25H23N3O2S — CID 123870308
(E)-2-[4-[1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]ethenesulfonamide (PubChem CID 123870308) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is (E)-2-[4-[1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]ethenesulfonamide.
| Compound Name | (E)-2-[4-[1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]ethenesulfonamide |
|---|---|
| PubChem CID | 123870308 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | (E)-2-[4-[1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]ethenesulfonamide |
| SMILES | CCC(=C(c1ccc(/C=C/S(N)(=O)=O)cc1)c1ccc2[nH]ncc2c1)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O2S/c1-2-23(19-6-4-3-5-7-19)25(21-12-13-24-22(16-21)17-27-28-24)20-10-8-18(9-11-20)14-15-31(26,29)30/h3-17H,2H2,1H3,(H,27,28)(H2,26,29,30)/b15-14+,25-23? |
| InChIKey | JHCLWWJIKXRUDM-VXBPXDQSSA-N |
| XLogP | 5.19 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|