C28H23N3OS — CID 148538481
3-[(E)-2-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]ethenyl]-4H-1,2-oxazole-5-thione (PubChem CID 148538481) has the molecular formula C28H23N3OS and a molecular weight of 449.58 g/mol. Its IUPAC name is 3-[(E)-2-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]ethenyl]-4H-1,2-oxazole-5-thione.
| Compound Name | 3-[(E)-2-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]ethenyl]-4H-1,2-oxazole-5-thione |
|---|---|
| PubChem CID | 148538481 |
| Molecular Formula | C28H23N3OS |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-[(E)-2-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]ethenyl]-4H-1,2-oxazole-5-thione |
| SMILES | CC/C(=C(/c1ccc(/C=C/C2=NOC(=S)C2)cc1)c1ccc2[nH]ncc2c1)c1ccccc1 |
| InChI | InChI=1S/C28H23N3OS/c1-2-25(20-6-4-3-5-7-20)28(22-13-15-26-23(16-22)18-29-30-26)21-11-8-19(9-12-21)10-14-24-17-27(33)32-31-24/h3-16,18H,2,17H2,1H3,(H,29,30)/b14-10+,28-25+ |
| InChIKey | MRRPPIGXIYPNLS-ARQVJJLASA-N |
| XLogP | 7.05 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|