C28H26N2O2 — CID 66794771
ethyl (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]prop-2-enoate (PubChem CID 66794771) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 66794771 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(/C(=C(/CC)c2ccccc2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C28H26N2O2/c1-3-25(21-8-6-5-7-9-21)28(23-15-16-26-24(18-23)19-29-30-26)22-13-10-20(11-14-22)12-17-27(31)32-4-2/h5-19H,3-4H2,1-2H3,(H,29,30)/b17-12+,28-25+ |
| InChIKey | QYISXUAHRNKVRR-UBQCLMHDSA-N |
| XLogP | 6.51 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|