C30H24N4O2 — CID 123873145
(E)-3-[4-[1-(1H-indazol-5-yl)-2-(4-pyrimidin-5-ylphenyl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 123873145) has the molecular formula C30H24N4O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is (E)-3-[4-[1-(1H-indazol-5-yl)-2-(4-pyrimidin-5-ylphenyl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[1-(1H-indazol-5-yl)-2-(4-pyrimidin-5-ylphenyl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123873145 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | (E)-3-[4-[1-(1H-indazol-5-yl)-2-(4-pyrimidin-5-ylphenyl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CCC(=C(c1ccc(/C=C/C(=O)O)cc1)c1ccc2[nH]ncc2c1)c1ccc(-c2cncnc2)cc1 |
| InChI | InChI=1S/C30H24N4O2/c1-2-27(22-10-8-21(9-11-22)26-16-31-19-32-17-26)30(24-12-13-28-25(15-24)18-33-34-28)23-6-3-20(4-7-23)5-14-29(35)36/h3-19H,2H2,1H3,(H,33,34)(H,35,36)/b14-5+,30-27? |
| InChIKey | CEXMEQVDKZZMIE-NYQZHTIISA-N |
| XLogP | 6.49 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|