C30H28N2O4 — CID 123557920
(E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-[3-methyl-4-(2-oxopropoxy)phenyl]but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 123557920) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-[3-methyl-4-(2-oxopropoxy)phenyl]but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-[3-methyl-4-(2-oxopropoxy)phenyl]but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123557920 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-[3-methyl-4-(2-oxopropoxy)phenyl]but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1ccc2[nH]ncc2c1)c1ccc(OCC(C)=O)c(C)c1 |
| InChI | InChI=1S/C30H28N2O4/c1-4-26(23-11-13-28(19(2)15-23)36-18-20(3)33)30(24-10-12-27-25(16-24)17-31-32-27)22-8-5-21(6-9-22)7-14-29(34)35/h5-17H,4,18H2,1-3H3,(H,31,32)(H,34,35)/b14-7+,30-26+ |
| InChIKey | QEKARFXFNMCFPS-ZJLINRTISA-N |
| XLogP | 6.31 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|