C26H23N3O3 — CID 66802336
3-[4-[1-(1H-indazol-5-yl)-2-(2-methoxy-4-pyridinyl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66802336) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[4-[1-(1H-indazol-5-yl)-2-(2-methoxy-4-pyridinyl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[1-(1H-indazol-5-yl)-2-(2-methoxy-4-pyridinyl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66802336 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-[4-[1-(1H-indazol-5-yl)-2-(2-methoxy-4-pyridinyl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CCC(=C(c1ccc(C=CC(=O)O)cc1)c1ccc2[nH]ncc2c1)c1ccnc(OC)c1 |
| InChI | InChI=1S/C26H23N3O3/c1-3-22(19-12-13-27-24(15-19)32-2)26(20-9-10-23-21(14-20)16-28-29-23)18-7-4-17(5-8-18)6-11-25(30)31/h4-16H,3H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | ZRELOBDBCZWUOK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|