C30H30N2O4 — CID 66803330
(E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-[3-(3-methoxypropoxy)phenyl]but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66803330) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-[3-(3-methoxypropoxy)phenyl]but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-[3-(3-methoxypropoxy)phenyl]but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66803330 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (E)-3-[4-[(E)-1-(1H-indazol-5-yl)-2-[3-(3-methoxypropoxy)phenyl]but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1ccc2[nH]ncc2c1)c1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C30H30N2O4/c1-3-27(23-6-4-7-26(19-23)36-17-5-16-35-2)30(24-13-14-28-25(18-24)20-31-32-28)22-11-8-21(9-12-22)10-15-29(33)34/h4,6-15,18-20H,3,5,16-17H2,1-2H3,(H,31,32)(H,33,34)/b15-10+,30-27+ |
| InChIKey | VGKFBNHJAXDCHW-YGIOWPMDSA-N |
| XLogP | 6.45 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|