C31H32N2O2 — CID 158067412
(E)-8-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]oct-3-en-2-one (PubChem CID 158067412) has the molecular formula C31H32N2O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is (E)-8-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]oct-3-en-2-one.
| Compound Name | (E)-8-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]oct-3-en-2-one |
|---|---|
| PubChem CID | 158067412 |
| Molecular Formula | C31H32N2O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (E)-8-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]oct-3-en-2-one |
| SMILES | CC/C(=C(/c1ccc(OCCCC/C=C/C(C)=O)cc1)c1ccc2[nH]ncc2c1)c1ccccc1 |
| InChI | InChI=1S/C31H32N2O2/c1-3-29(24-12-8-6-9-13-24)31(26-16-19-30-27(21-26)22-32-33-30)25-14-17-28(18-15-25)35-20-10-5-4-7-11-23(2)34/h6-9,11-19,21-22H,3-5,10,20H2,1-2H3,(H,32,33)/b11-7+,31-29+ |
| InChIKey | WJSDTTHYEYFAOY-OEHMVMSISA-N |
| XLogP | 7.63 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|