C31H34N4O2 — CID 159991938
(E)-N,N-dimethyl-7-[4-[(E)-2-phenyl-1-(1H-pyrazolo[4,5-b]pyridin-5-yl)but-1-enyl]phenoxy]hept-2-enamide (PubChem CID 159991938) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is (E)-N,N-dimethyl-7-[4-[(E)-2-phenyl-1-(1H-pyrazolo[4,5-b]pyridin-5-yl)but-1-enyl]phenoxy]hept-2-enamide.
| Compound Name | (E)-N,N-dimethyl-7-[4-[(E)-2-phenyl-1-(1H-pyrazolo[4,5-b]pyridin-5-yl)but-1-enyl]phenoxy]hept-2-enamide |
|---|---|
| PubChem CID | 159991938 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (E)-N,N-dimethyl-7-[4-[(E)-2-phenyl-1-(1H-pyrazolo[4,5-b]pyridin-5-yl)but-1-enyl]phenoxy]hept-2-enamide |
| SMILES | CC/C(=C(/c1ccc(OCCCC/C=C/C(=O)N(C)C)cc1)c1ccc2[nH]ncc2n1)c1ccccc1 |
| InChI | InChI=1S/C31H34N4O2/c1-4-26(23-12-8-7-9-13-23)31(28-20-19-27-29(33-28)22-32-34-27)24-15-17-25(18-16-24)37-21-11-6-5-10-14-30(36)35(2)3/h7-10,12-20,22H,4-6,11,21H2,1-3H3,(H,32,34)/b14-10+,31-26+ |
| InChIKey | OHBDPAWOOCQRCO-CINPURKFSA-N |
| XLogP | 6.52 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|