C31H34N4O2 — CID 175930437
2-[ethyl-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]amino]-N,N-dimethylbut-2-enamide (PubChem CID 175930437) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[ethyl-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]amino]-N,N-dimethylbut-2-enamide.
| Compound Name | 2-[ethyl-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]amino]-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 175930437 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 2-[ethyl-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]amino]-N,N-dimethylbut-2-enamide |
| SMILES | CC=C(C(=O)N(C)C)N(CC)Oc1ccc(/C(=C(/CC)c2ccccc2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C31H34N4O2/c1-6-27(22-12-10-9-11-13-22)30(24-16-19-28-25(20-24)21-32-33-28)23-14-17-26(18-15-23)37-35(8-3)29(7-2)31(36)34(4)5/h7,9-21H,6,8H2,1-5H3,(H,32,33)/b29-7?,30-27+ |
| InChIKey | NOJCNTNHZJXYTF-JIHUCPEQSA-N |
| XLogP | 6.54 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|