C35H37N3O2 — CID 158379723
(E)-N-but-3-ynyl-7-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]-N-methylhept-2-enamide (PubChem CID 158379723) has the molecular formula C35H37N3O2 and a molecular weight of 531.70 g/mol. Its IUPAC name is (E)-N-but-3-ynyl-7-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]-N-methylhept-2-enamide.
| Compound Name | (E)-N-but-3-ynyl-7-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]-N-methylhept-2-enamide |
|---|---|
| PubChem CID | 158379723 |
| Molecular Formula | C35H37N3O2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | (E)-N-but-3-ynyl-7-[4-[(E)-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]-N-methylhept-2-enamide |
| SMILES | C#CCCN(C)C(=O)/C=C/CCCCOc1ccc(/C(=C(/CC)c2ccccc2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C35H37N3O2/c1-4-6-23-38(3)34(39)16-12-7-8-13-24-40-31-20-17-28(18-21-31)35(32(5-2)27-14-10-9-11-15-27)29-19-22-33-30(25-29)26-36-37-33/h1,9-12,14-22,25-26H,5-8,13,23-24H2,2-3H3,(H,36,37)/b16-12+,35-32+ |
| InChIKey | GVQHOVPOOKKMHT-BVQKNSOUSA-N |
| XLogP | 7.52 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|