C34H37N3O2 — CID 158658674
(E)-7-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-phenylethenyl]phenoxy]-N,N-dimethylhept-2-enamide (PubChem CID 158658674) has the molecular formula C34H37N3O2 and a molecular weight of 519.69 g/mol. Its IUPAC name is (E)-7-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-phenylethenyl]phenoxy]-N,N-dimethylhept-2-enamide.
| Compound Name | (E)-7-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-phenylethenyl]phenoxy]-N,N-dimethylhept-2-enamide |
|---|---|
| PubChem CID | 158658674 |
| Molecular Formula | C34H37N3O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | (E)-7-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-phenylethenyl]phenoxy]-N,N-dimethylhept-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CCCCOc1ccc(/C(=C(\c2ccccc2)C2CCC2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C34H37N3O2/c1-37(2)32(38)15-8-3-4-9-22-39-30-19-16-27(17-20-30)34(28-18-21-31-29(23-28)24-35-36-31)33(26-13-10-14-26)25-11-6-5-7-12-25/h5-8,11-12,15-21,23-24,26H,3-4,9-10,13-14,22H2,1-2H3,(H,35,36)/b15-8+,34-33- |
| InChIKey | ICMAMTGIQRFZFX-MBTRPFQPSA-N |
| XLogP | 7.52 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|