C32H36N4O2 — CID 134530855
4-[2-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-phenylethenyl]phenoxy]ethylamino]-N-methylbutanamide (PubChem CID 134530855) has the molecular formula C32H36N4O2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 4-[2-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-phenylethenyl]phenoxy]ethylamino]-N-methylbutanamide.
| Compound Name | 4-[2-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-phenylethenyl]phenoxy]ethylamino]-N-methylbutanamide |
|---|---|
| PubChem CID | 134530855 |
| Molecular Formula | C32H36N4O2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 4-[2-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-phenylethenyl]phenoxy]ethylamino]-N-methylbutanamide |
| SMILES | CNC(=O)CCCNCCOc1ccc(/C(=C(\c2ccccc2)C2CCC2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C32H36N4O2/c1-33-30(37)11-6-18-34-19-20-38-28-15-12-25(13-16-28)32(26-14-17-29-27(21-26)22-35-36-29)31(24-9-5-10-24)23-7-3-2-4-8-23/h2-4,7-8,12-17,21-22,24,34H,5-6,9-11,18-20H2,1H3,(H,33,37)(H,35,36)/b32-31- |
| InChIKey | SHNXHZBJIRSINX-MVJHLKBCSA-N |
| XLogP | 5.82 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|