C30H25N3O3 — CID 123200104
(E)-3-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-(2-isocyano-4-methoxyphenyl)ethenyl]phenyl]prop-2-enoic acid (PubChem CID 123200104) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-(2-isocyano-4-methoxyphenyl)ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-(2-isocyano-4-methoxyphenyl)ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123200104 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (E)-3-[4-[(E)-2-cyclobutyl-1-(1H-indazol-5-yl)-2-(2-isocyano-4-methoxyphenyl)ethenyl]phenyl]prop-2-enoic acid |
| SMILES | [C-]#[N+]c1cc(OC)ccc1/C(=C(\c1ccc(/C=C/C(=O)O)cc1)c1ccc2[nH]ncc2c1)C1CCC1 |
| InChI | InChI=1S/C30H25N3O3/c1-31-27-17-24(36-2)12-13-25(27)30(20-4-3-5-20)29(22-11-14-26-23(16-22)18-32-33-26)21-9-6-19(7-10-21)8-15-28(34)35/h6-18,20H,3-5H2,2H3,(H,32,33)(H,34,35)/b15-8+,30-29+ |
| InChIKey | TZRBDUNHVBHOCM-NDBQIFHMSA-N |
| XLogP | 6.98 |
| TPSA | 79.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|