C30H20ClFN4O2 — CID 123311849
(E)-3-[4-[(E)-2-(4-chloro-2-isocyanophenyl)-1-(4-cyano-3-fluoro-2H-indazol-5-yl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid (PubChem CID 123311849) has the molecular formula C30H20ClFN4O2 and a molecular weight of 522.97 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(4-chloro-2-isocyanophenyl)-1-(4-cyano-3-fluoro-2H-indazol-5-yl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(4-chloro-2-isocyanophenyl)-1-(4-cyano-3-fluoro-2H-indazol-5-yl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123311849 |
| Molecular Formula | C30H20ClFN4O2 |
| Molecular Weight | 522.97 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | (E)-3-[4-[(E)-2-(4-chloro-2-isocyanophenyl)-1-(4-cyano-3-fluoro-2H-indazol-5-yl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
| SMILES | [C-]#[N+]c1cc(Cl)ccc1/C(=C(\c1ccc(/C=C/C(=O)O)cc1)c1ccc2n[nH]c(F)c2c1C#N)C1CCC1 |
| InChI | InChI=1S/C30H20ClFN4O2/c1-34-25-15-20(31)10-11-22(25)28(18-3-2-4-18)27(19-8-5-17(6-9-19)7-14-26(37)38)21-12-13-24-29(23(21)16-33)30(32)36-35-24/h5-15,18H,2-4H2,(H,35,36)(H,37,38)/b14-7+,28-27+ |
| InChIKey | STJOLEJQMSEGRT-IELKENRMSA-N |
| XLogP | 7.63 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.97 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|