C28H19F2N3O2 — CID 123702464
(E)-3-[4-[1-(4-cyano-3-fluoro-2H-indazol-5-yl)-2-cyclopropyl-2-(2-fluorophenyl)ethenyl]phenyl]prop-2-enoic acid (PubChem CID 123702464) has the molecular formula C28H19F2N3O2 and a molecular weight of 467.48 g/mol. Its IUPAC name is (E)-3-[4-[1-(4-cyano-3-fluoro-2H-indazol-5-yl)-2-cyclopropyl-2-(2-fluorophenyl)ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[1-(4-cyano-3-fluoro-2H-indazol-5-yl)-2-cyclopropyl-2-(2-fluorophenyl)ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123702464 |
| Molecular Formula | C28H19F2N3O2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (E)-3-[4-[1-(4-cyano-3-fluoro-2H-indazol-5-yl)-2-cyclopropyl-2-(2-fluorophenyl)ethenyl]phenyl]prop-2-enoic acid |
| SMILES | N#Cc1c(C(=C(c2ccccc2F)C2CC2)c2ccc(/C=C/C(=O)O)cc2)ccc2n[nH]c(F)c12 |
| InChI | InChI=1S/C28H19F2N3O2/c29-22-4-2-1-3-20(22)26(18-10-11-18)25(17-8-5-16(6-9-17)7-14-24(34)35)19-12-13-23-27(21(19)15-31)28(30)33-32-23/h1-9,12-14,18H,10-11H2,(H,32,33)(H,34,35)/b14-7+,26-25? |
| InChIKey | WWCVXYGINCEUDJ-MELRFXJQSA-N |
| XLogP | 6.18 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|