C30H27FN2O — CID 161309359
(E)-1-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-phenylethenyl]phenyl]pent-1-en-3-one (PubChem CID 161309359) has the molecular formula C30H27FN2O and a molecular weight of 450.56 g/mol. Its IUPAC name is (E)-1-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-phenylethenyl]phenyl]pent-1-en-3-one.
| Compound Name | (E)-1-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-phenylethenyl]phenyl]pent-1-en-3-one |
|---|---|
| PubChem CID | 161309359 |
| Molecular Formula | C30H27FN2O |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (E)-1-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-phenylethenyl]phenyl]pent-1-en-3-one |
| SMILES | CCC(=O)/C=C/c1ccc(/C(=C(\c2ccccc2)C2CCC2)c2ccc3n[nH]c(F)c3c2)cc1 |
| InChI | InChI=1S/C30H27FN2O/c1-2-25(34)17-13-20-11-14-23(15-12-20)29(24-16-18-27-26(19-24)30(31)33-32-27)28(22-9-6-10-22)21-7-4-3-5-8-21/h3-5,7-8,11-19,22H,2,6,9-10H2,1H3,(H,32,33)/b17-13+,29-28- |
| InChIKey | VIRICUSUJNQIMH-CFEWSEOGSA-N |
| XLogP | 7.45 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|