C29H21ClFN3O2 — CID 71745165
(E)-3-[4-[(E)-2-(4-chloro-2-cyanophenyl)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)ethenyl]phenyl]prop-2-enoic acid (PubChem CID 71745165) has the molecular formula C29H21ClFN3O2 and a molecular weight of 497.96 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(4-chloro-2-cyanophenyl)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(4-chloro-2-cyanophenyl)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71745165 |
| Molecular Formula | C29H21ClFN3O2 |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (E)-3-[4-[(E)-2-(4-chloro-2-cyanophenyl)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)ethenyl]phenyl]prop-2-enoic acid |
| SMILES | N#Cc1cc(Cl)ccc1/C(=C(\c1ccc(/C=C/C(=O)O)cc1)c1ccc2n[nH]c(F)c2c1)C1CCC1 |
| InChI | InChI=1S/C29H21ClFN3O2/c30-22-10-11-23(21(14-22)16-32)28(18-2-1-3-18)27(19-7-4-17(5-8-19)6-13-26(35)36)20-9-12-25-24(15-20)29(31)34-33-25/h4-15,18H,1-3H2,(H,33,34)(H,35,36)/b13-6+,28-27+ |
| InChIKey | ZNGIVMOXUVDEBW-GWYNGDBJSA-N |
| XLogP | 7.08 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|