C27H21ClF2N2O2 — CID 154070851
3-[4-[2-(4-chloro-2-fluorophenyl)-1-(3-fluoro-2H-indazol-5-yl)-3-methylbut-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 154070851) has the molecular formula C27H21ClF2N2O2 and a molecular weight of 478.93 g/mol. Its IUPAC name is 3-[4-[2-(4-chloro-2-fluorophenyl)-1-(3-fluoro-2H-indazol-5-yl)-3-methylbut-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-(4-chloro-2-fluorophenyl)-1-(3-fluoro-2H-indazol-5-yl)-3-methylbut-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 154070851 |
| Molecular Formula | C27H21ClF2N2O2 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-[4-[2-(4-chloro-2-fluorophenyl)-1-(3-fluoro-2H-indazol-5-yl)-3-methylbut-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)C(=C(c1ccc(C=CC(=O)O)cc1)c1ccc2n[nH]c(F)c2c1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C27H21ClF2N2O2/c1-15(2)25(20-10-9-19(28)14-22(20)29)26(17-6-3-16(4-7-17)5-12-24(33)34)18-8-11-23-21(13-18)27(30)32-31-23/h3-15H,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | LURLJMXYOKBZPQ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|