C28H25FN2O3 — CID 154070852
3-[4-[1-(3-fluoro-2H-indazol-5-yl)-2-(4-methoxy-2-methylphenyl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 154070852) has the molecular formula C28H25FN2O3 and a molecular weight of 456.52 g/mol. Its IUPAC name is 3-[4-[1-(3-fluoro-2H-indazol-5-yl)-2-(4-methoxy-2-methylphenyl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[1-(3-fluoro-2H-indazol-5-yl)-2-(4-methoxy-2-methylphenyl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 154070852 |
| Molecular Formula | C28H25FN2O3 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-[4-[1-(3-fluoro-2H-indazol-5-yl)-2-(4-methoxy-2-methylphenyl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CCC(=C(c1ccc(C=CC(=O)O)cc1)c1ccc2n[nH]c(F)c2c1)c1ccc(OC)cc1C |
| InChI | InChI=1S/C28H25FN2O3/c1-4-22(23-12-11-21(34-3)15-17(23)2)27(19-8-5-18(6-9-19)7-14-26(32)33)20-10-13-25-24(16-20)28(29)31-30-25/h5-16H,4H2,1-3H3,(H,30,31)(H,32,33) |
| InChIKey | CBOCKJWDOMJBIA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|