C27H25ClN2O3 — CID 88587559
(E)-3-[4-[(E)-2-(2-chloro-4-methoxyphenyl)-1-[3-[(Z)-hydrazinylidenemethyl]phenyl]but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 88587559) has the molecular formula C27H25ClN2O3 and a molecular weight of 460.96 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(2-chloro-4-methoxyphenyl)-1-[3-[(Z)-hydrazinylidenemethyl]phenyl]but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(2-chloro-4-methoxyphenyl)-1-[3-[(Z)-hydrazinylidenemethyl]phenyl]but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 88587559 |
| Molecular Formula | C27H25ClN2O3 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (E)-3-[4-[(E)-2-(2-chloro-4-methoxyphenyl)-1-[3-[(Z)-hydrazinylidenemethyl]phenyl]but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1cccc(/C=N\N)c1)c1ccc(OC)cc1Cl |
| InChI | InChI=1S/C27H25ClN2O3/c1-3-23(24-13-12-22(33-2)16-25(24)28)27(21-6-4-5-19(15-21)17-30-29)20-10-7-18(8-11-20)9-14-26(31)32/h4-17H,3,29H2,1-2H3,(H,31,32)/b14-9+,27-23+,30-17- |
| InChIKey | IVAOSOUMMZOGDV-UGLLCODASA-N |
| XLogP | 6.11 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|