C30H27ClO2 — CID 161121134
(E)-3-[4-[(E)-2-(2-chloro-4-methylphenyl)-1-(3-methyl-1H-inden-2-yl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 161121134) has the molecular formula C30H27ClO2 and a molecular weight of 455.00 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(2-chloro-4-methylphenyl)-1-(3-methyl-1H-inden-2-yl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(2-chloro-4-methylphenyl)-1-(3-methyl-1H-inden-2-yl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 161121134 |
| Molecular Formula | C30H27ClO2 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (E)-3-[4-[(E)-2-(2-chloro-4-methylphenyl)-1-(3-methyl-1H-inden-2-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(\C1=C(C)c2ccccc2C1)c1ccc(/C=C/C(=O)O)cc1)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C30H27ClO2/c1-4-24(26-15-9-19(2)17-28(26)31)30(22-13-10-21(11-14-22)12-16-29(32)33)27-18-23-7-5-6-8-25(23)20(27)3/h5-17H,4,18H2,1-3H3,(H,32,33)/b16-12+,30-24+ |
| InChIKey | UOAJZVMPEKDRHK-COHIKYHCSA-N |
| XLogP | 8.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|