C26H19Cl2FN2O2 — CID 66793533
(E)-3-[4-[(E)-2-(2,4-dichlorophenyl)-1-(7-fluoro-1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66793533) has the molecular formula C26H19Cl2FN2O2 and a molecular weight of 481.35 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(2,4-dichlorophenyl)-1-(7-fluoro-1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(2,4-dichlorophenyl)-1-(7-fluoro-1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66793533 |
| Molecular Formula | C26H19Cl2FN2O2 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (E)-3-[4-[(E)-2-(2,4-dichlorophenyl)-1-(7-fluoro-1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1cc(F)c2[nH]ncc2c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H19Cl2FN2O2/c1-2-20(21-9-8-19(27)13-22(21)28)25(16-6-3-15(4-7-16)5-10-24(32)33)17-11-18-14-30-31-26(18)23(29)12-17/h3-14H,2H2,1H3,(H,30,31)(H,32,33)/b10-5+,25-20+ |
| InChIKey | HHBQCWWOGRMDNS-XELCXUBQSA-N |
| XLogP | 7.48 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|