C26H20Cl2N2O2 — CID 123905443
3-[4-[3,3,4-trideuterio-2-(2,4-dichlorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 123905443) has the molecular formula C26H20Cl2N2O2 and a molecular weight of 466.38 g/mol. Its IUPAC name is 3-[4-[3,3,4-trideuterio-2-(2,4-dichlorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[3,3,4-trideuterio-2-(2,4-dichlorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123905443 |
| Molecular Formula | C26H20Cl2N2O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 3-[4-[3,3,4-trideuterio-2-(2,4-dichlorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | [2H]CC([2H])([2H])C(=C(c1ccc(C=CC(=O)O)cc1)c1ccc2[nH]ncc2c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H20Cl2N2O2/c1-2-21(22-10-9-20(27)14-23(22)28)26(18-8-11-24-19(13-18)15-29-30-24)17-6-3-16(4-7-17)5-12-25(31)32/h3-15H,2H2,1H3,(H,29,30)(H,31,32)/i1D,2D2 |
| InChIKey | OJSGCLBRJPCHGI-APAIHEESSA-N |
| XLogP | 7.34 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|