C28H22ClFIO2- — CID 157434236
(E)-3-[4-[(Z)-2-(2-chloro-4-fluorophenyl)-1-(1H-inden-2-yl)but-1-enyl]phenyl]prop-2-enoic acid iodide (PubChem CID 157434236) has the molecular formula C28H22ClFIO2- and a molecular weight of 571.84 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-2-(2-chloro-4-fluorophenyl)-1-(1H-inden-2-yl)but-1-enyl]phenyl]prop-2-enoic acid iodide.
| Compound Name | (E)-3-[4-[(Z)-2-(2-chloro-4-fluorophenyl)-1-(1H-inden-2-yl)but-1-enyl]phenyl]prop-2-enoic acid iodide |
|---|---|
| PubChem CID | 157434236 |
| Molecular Formula | C28H22ClFIO2- |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | (E)-3-[4-[(Z)-2-(2-chloro-4-fluorophenyl)-1-(1H-inden-2-yl)but-1-enyl]phenyl]prop-2-enoic acid iodide |
| SMILES | CC/C(=C(\C1=Cc2ccccc2C1)c1ccc(/C=C/C(=O)O)cc1)c1ccc(F)cc1Cl.[I-] |
| InChI | InChI=1S/C28H22ClFO2.HI/c1-2-24(25-13-12-23(30)17-26(25)29)28(22-15-20-5-3-4-6-21(20)16-22)19-10-7-18(8-11-19)9-14-27(31)32;/h3-15,17H,2,16H2,1H3,(H,31,32);1H/p-1/b14-9+,28-24+; |
| InChIKey | XMYAPJKQEHQCPA-NUHZBTJUSA-M |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|