C30H26ClFN2O3 — CID 66806701
(E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(2-methylpropanoyl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66806701) has the molecular formula C30H26ClFN2O3 and a molecular weight of 517.00 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(2-methylpropanoyl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(2-methylpropanoyl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66806701 |
| Molecular Formula | C30H26ClFN2O3 |
| Molecular Weight | 517.00 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(2-methylpropanoyl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1ccc2c(cnn2C(=O)C(C)C)c1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C30H26ClFN2O3/c1-4-24(25-12-11-23(32)16-26(25)31)29(20-8-5-19(6-9-20)7-14-28(35)36)21-10-13-27-22(15-21)17-33-34(27)30(37)18(2)3/h5-18H,4H2,1-3H3,(H,35,36)/b14-7+,29-24+ |
| InChIKey | IEJNCIZDOZFICI-MTSWAYFVSA-N |
| XLogP | 7.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.00 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|