C29H25ClFNO2 — CID 137445379
ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indol-2-yl)but-1-enyl]phenyl]prop-2-enoate (PubChem CID 137445379) has the molecular formula C29H25ClFNO2 and a molecular weight of 473.98 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indol-2-yl)but-1-enyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indol-2-yl)but-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 137445379 |
| Molecular Formula | C29H25ClFNO2 |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indol-2-yl)but-1-enyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(/C(=C(/CC)c2ccc(F)cc2Cl)c2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C29H25ClFNO2/c1-3-23(24-15-14-22(31)18-25(24)30)29(27-17-21-7-5-6-8-26(21)32-27)20-12-9-19(10-13-20)11-16-28(33)34-4-2/h5-18,32H,3-4H2,1-2H3/b16-11+,29-23+ |
| InChIKey | YWAVZPZQGHQMDM-MHDBADHVSA-N |
| XLogP | 7.91 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|