C33H34ClFN2O3 — CID 90179346
ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)-2,3-dihydroindazol-5-yl]but-1-enyl]phenyl]prop-2-enoate (PubChem CID 90179346) has the molecular formula C33H34ClFN2O3 and a molecular weight of 561.10 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)-2,3-dihydroindazol-5-yl]but-1-enyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)-2,3-dihydroindazol-5-yl]but-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90179346 |
| Molecular Formula | C33H34ClFN2O3 |
| Molecular Weight | 561.10 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)-2,3-dihydroindazol-5-yl]but-1-enyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(/C(=C(/CC)c2ccc(F)cc2Cl)c2ccc3c(c2)CNN3C2CCCCO2)cc1 |
| InChI | InChI=1S/C33H34ClFN2O3/c1-3-27(28-15-14-26(35)20-29(28)34)33(23-11-8-22(9-12-23)10-17-32(38)39-4-2)24-13-16-30-25(19-24)21-36-37(30)31-7-5-6-18-40-31/h8-17,19-20,31,36H,3-7,18,21H2,1-2H3/b17-10+,33-27+ |
| InChIKey | MCFNARHSBZEFQM-GTMPFSIZSA-N |
| XLogP | 7.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.10 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|