C38H36ClN3O3 — CID 140753668
ethyl (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-[1-(oxan-2-yl)pyrazol-4-yl]phenyl]ethenyl]phenyl]prop-2-enoate (PubChem CID 140753668) has the molecular formula C38H36ClN3O3 and a molecular weight of 618.18 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-[1-(oxan-2-yl)pyrazol-4-yl]phenyl]ethenyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-[1-(oxan-2-yl)pyrazol-4-yl]phenyl]ethenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 140753668 |
| Molecular Formula | C38H36ClN3O3 |
| Molecular Weight | 618.18 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-[1-(oxan-2-yl)pyrazol-4-yl]phenyl]ethenyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(/C(=C(\c2ccc(C#N)cc2Cl)C2CCC2)c2ccc(-c3cnn(C4CCCCO4)c3)cc2)cc1 |
| InChI | InChI=1S/C38H36ClN3O3/c1-2-44-36(43)20-12-26-9-13-30(14-10-26)37(38(29-6-5-7-29)33-19-11-27(23-40)22-34(33)39)31-17-15-28(16-18-31)32-24-41-42(25-32)35-8-3-4-21-45-35/h9-20,22,24-25,29,35H,2-8,21H2,1H3/b20-12+,38-37+ |
| InChIKey | AYYXTGGRMDOIPF-ZLWXWKDRSA-N |
| XLogP | 9.11 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.18 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|