C37H42N2O4 — CID 77191670
ethyl 3-[4-[2-(3-butoxyphenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate (PubChem CID 77191670) has the molecular formula C37H42N2O4 and a molecular weight of 578.75 g/mol. Its IUPAC name is ethyl 3-[4-[2-(3-butoxyphenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[2-(3-butoxyphenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 77191670 |
| Molecular Formula | C37H42N2O4 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | ethyl 3-[4-[2-(3-butoxyphenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate |
| SMILES | CCCCOc1cccc(C(CC)=C(c2ccc(C=CC(=O)OCC)cc2)c2ccc3c(cnn3C3CCCCO3)c2)c1 |
| InChI | InChI=1S/C37H42N2O4/c1-4-7-22-42-32-12-10-11-29(25-32)33(5-2)37(28-17-14-27(15-18-28)16-21-36(40)41-6-3)30-19-20-34-31(24-30)26-38-39(34)35-13-8-9-23-43-35/h10-12,14-21,24-26,35H,4-9,13,22-23H2,1-3H3 |
| InChIKey | UQBZWHTZUCIXOP-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|