C38H37N3O3 — CID 66803146
3-[4-[2-[4-(N-methylanilino)phenyl]-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66803146) has the molecular formula C38H37N3O3 and a molecular weight of 583.73 g/mol. Its IUPAC name is 3-[4-[2-[4-(N-methylanilino)phenyl]-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-[4-(N-methylanilino)phenyl]-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66803146 |
| Molecular Formula | C38H37N3O3 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 3-[4-[2-[4-(N-methylanilino)phenyl]-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CCC(=C(c1ccc(C=CC(=O)O)cc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccc(N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H37N3O3/c1-3-34(28-17-20-33(21-18-28)40(2)32-9-5-4-6-10-32)38(29-15-12-27(13-16-29)14-23-37(42)43)30-19-22-35-31(25-30)26-39-41(35)36-11-7-8-24-44-36/h4-6,9-10,12-23,25-26,36H,3,7-8,11,24H2,1-2H3,(H,42,43) |
| InChIKey | HTGJUIYYMFKCDN-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|