C34H40N4O4 — CID 158265946
tert-butyl 4-[5-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]pyrimidin-2-yl]oxybutanoate (PubChem CID 158265946) has the molecular formula C34H40N4O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is tert-butyl 4-[5-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]pyrimidin-2-yl]oxybutanoate.
| Compound Name | tert-butyl 4-[5-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]pyrimidin-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 158265946 |
| Molecular Formula | C34H40N4O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | tert-butyl 4-[5-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]pyrimidin-2-yl]oxybutanoate |
| SMILES | CC/C(=C(/c1cnc(OCCCC(=O)OC(C)(C)C)nc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C34H40N4O4/c1-5-28(24-12-7-6-8-13-24)32(25-16-17-29-26(20-25)23-37-38(29)30-14-9-10-18-40-30)27-21-35-33(36-22-27)41-19-11-15-31(39)42-34(2,3)4/h6-8,12-13,16-17,20-23,30H,5,9-11,14-15,18-19H2,1-4H3/b32-28- |
| InChIKey | GMFHDPUDTUHUAZ-BLCKFSMSSA-N |
| XLogP | 7.40 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|