C36H49BN2O6 — CID 157315570
tert-butyl 4-[4-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]phenoxy]butanoate (PubChem CID 157315570) has the molecular formula C36H49BN2O6 and a molecular weight of 616.61 g/mol. Its IUPAC name is tert-butyl 4-[4-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]phenoxy]butanoate.
| Compound Name | tert-butyl 4-[4-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 157315570 |
| Molecular Formula | C36H49BN2O6 |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.37 |
| IUPAC Name | tert-butyl 4-[4-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]phenoxy]butanoate |
| SMILES | CC/C(B1OC(C)(C)C(C)(C)O1)=C(/c1ccc(OCCCC(=O)OC(C)(C)C)cc1)c1ccc2c(cnn2C2CCCCO2)c1 |
| InChI | InChI=1S/C36H49BN2O6/c1-9-29(37-44-35(5,6)36(7,8)45-37)33(25-15-18-28(19-16-25)41-22-12-14-32(40)43-34(2,3)4)26-17-20-30-27(23-26)24-38-39(30)31-13-10-11-21-42-31/h15-20,23-24,31H,9-14,21-22H2,1-8H3/b33-29+ |
| InChIKey | RODJHDSEKLAWLH-XPXRSFDGSA-N |
| XLogP | 8.08 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|