C30H37BN2O3 — CID 140874193
5-[(E)-2-cyclobutyl-2-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(oxan-2-yl)indazole (PubChem CID 140874193) has the molecular formula C30H37BN2O3 and a molecular weight of 484.45 g/mol. Its IUPAC name is 5-[(E)-2-cyclobutyl-2-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(oxan-2-yl)indazole.
| Compound Name | 5-[(E)-2-cyclobutyl-2-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 140874193 |
| Molecular Formula | C30H37BN2O3 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 5-[(E)-2-cyclobutyl-2-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(oxan-2-yl)indazole |
| SMILES | CC1(C)OB(/C(=C(\c2ccccc2)C2CCC2)c2ccc3c(cnn3C3CCCCO3)c2)OC1(C)C |
| InChI | InChI=1S/C30H37BN2O3/c1-29(2)30(3,4)36-31(35-29)28(27(22-13-10-14-22)21-11-6-5-7-12-21)23-16-17-25-24(19-23)20-32-33(25)26-15-8-9-18-34-26/h5-7,11-12,16-17,19-20,22,26H,8-10,13-15,18H2,1-4H3/b28-27+ |
| InChIKey | NXKOXDUCEGCHJQ-BYYHNAKLSA-N |
| XLogP | 7.08 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|