C32H32N2O3 — CID 66793214
2-methyl-3-[4-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66793214) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 2-methyl-3-[4-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 2-methyl-3-[4-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66793214 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 2-methyl-3-[4-[(Z)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(\c1ccc(C=C(C)C(=O)O)cc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C32H32N2O3/c1-3-28(24-9-5-4-6-10-24)31(25-14-12-23(13-15-25)19-22(2)32(35)36)26-16-17-29-27(20-26)21-33-34(29)30-11-7-8-18-37-30/h4-6,9-10,12-17,19-21,30H,3,7-8,11,18H2,1-2H3,(H,35,36)/b22-19?,31-28- |
| InChIKey | MUFRWJQQRNGBTK-ITMBSLMGSA-N |
| XLogP | 7.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|