C31H29BrN2O3 — CID 66802103
3-[4-[(Z)-2-(4-bromophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66802103) has the molecular formula C31H29BrN2O3 and a molecular weight of 557.49 g/mol. Its IUPAC name is 3-[4-[(Z)-2-(4-bromophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(Z)-2-(4-bromophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66802103 |
| Molecular Formula | C31H29BrN2O3 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 3-[4-[(Z)-2-(4-bromophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(\c1ccc(C=CC(=O)O)cc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H29BrN2O3/c1-2-27(22-11-14-26(32)15-12-22)31(23-9-6-21(7-10-23)8-17-30(35)36)24-13-16-28-25(19-24)20-33-34(28)29-5-3-4-18-37-29/h6-17,19-20,29H,2-5,18H2,1H3,(H,35,36)/b17-8?,31-27- |
| InChIKey | SRHDWQNFUZULOP-BKHQUQRTSA-N |
| XLogP | 7.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|