C35H38N2O4 — CID 66801415
3-[4-[(E)-2-(3-butoxyphenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66801415) has the molecular formula C35H38N2O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is 3-[4-[(E)-2-(3-butoxyphenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(E)-2-(3-butoxyphenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66801415 |
| Molecular Formula | C35H38N2O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 3-[4-[(E)-2-(3-butoxyphenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CCCCOc1cccc(/C(CC)=C(\c2ccc(C=CC(=O)O)cc2)c2ccc3c(cnn3C3CCCCO3)c2)c1 |
| InChI | InChI=1S/C35H38N2O4/c1-3-5-20-40-30-10-8-9-27(23-30)31(4-2)35(26-15-12-25(13-16-26)14-19-34(38)39)28-17-18-32-29(22-28)24-36-37(32)33-11-6-7-21-41-33/h8-10,12-19,22-24,33H,3-7,11,20-21H2,1-2H3,(H,38,39)/b19-14?,35-31+ |
| InChIKey | JVANHFGSZUTTJF-JCQNDPLZSA-N |
| XLogP | 8.38 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|