C31H35N3O2 — CID 145199877
2-[4-[(E)-3-methyl-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethanamine (PubChem CID 145199877) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 2-[4-[(E)-3-methyl-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethanamine.
| Compound Name | 2-[4-[(E)-3-methyl-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 145199877 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 2-[4-[(E)-3-methyl-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethanamine |
| SMILES | CC(C)/C(=C(/c1ccc(OCCN)cc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C31H35N3O2/c1-22(2)30(23-8-4-3-5-9-23)31(24-11-14-27(15-12-24)35-19-17-32)25-13-16-28-26(20-25)21-33-34(28)29-10-6-7-18-36-29/h3-5,8-9,11-16,20-22,29H,6-7,10,17-19,32H2,1-2H3/b31-30+ |
| InChIKey | HQSCQZHATGXFOM-NVQSTNCTSA-N |
| XLogP | 6.69 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|