C23H27N3O4 — CID 175406283
benzyl N-[3-hydroxy-3-[1-(oxan-2-yl)indazol-5-yl]propyl]carbamate (PubChem CID 175406283) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is benzyl N-[3-hydroxy-3-[1-(oxan-2-yl)indazol-5-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-hydroxy-3-[1-(oxan-2-yl)indazol-5-yl]propyl]carbamate |
|---|---|
| PubChem CID | 175406283 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | benzyl N-[3-hydroxy-3-[1-(oxan-2-yl)indazol-5-yl]propyl]carbamate |
| SMILES | O=C(NCCC(O)c1ccc2c(cnn2C2CCCCO2)c1)OCc1ccccc1 |
| InChI | InChI=1S/C23H27N3O4/c27-21(11-12-24-23(28)30-16-17-6-2-1-3-7-17)18-9-10-20-19(14-18)15-25-26(20)22-8-4-5-13-29-22/h1-3,6-7,9-10,14-15,21-22,27H,4-5,8,11-13,16H2,(H,24,28) |
| InChIKey | WPGOSNZDKAOZHB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |