C20H23N3O3 — CID 170463279
benzyl N-[4-[1-[(2S)-oxan-2-yl]pyrazol-4-yl]but-3-ynyl]carbamate (PubChem CID 170463279) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is benzyl N-[4-[1-[(2S)-oxan-2-yl]pyrazol-4-yl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[1-[(2S)-oxan-2-yl]pyrazol-4-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463279 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | benzyl N-[4-[1-[(2S)-oxan-2-yl]pyrazol-4-yl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cnn([C@@H]2CCCCO2)c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H23N3O3/c24-20(26-16-17-8-2-1-3-9-17)21-12-6-4-10-18-14-22-23(15-18)19-11-5-7-13-25-19/h1-3,8-9,14-15,19H,5-7,11-13,16H2,(H,21,24)/t19-/m0/s1 |
| InChIKey | XNSZVOBAZVLZTP-IBGZPJMESA-N |
| XLogP | 3.25 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|