C21H18N4O4 — CID 170463540
benzyl N-[4-[1-(2-nitrophenyl)pyrazol-4-yl]but-3-ynyl]carbamate (PubChem CID 170463540) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is benzyl N-[4-[1-(2-nitrophenyl)pyrazol-4-yl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[1-(2-nitrophenyl)pyrazol-4-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463540 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | benzyl N-[4-[1-(2-nitrophenyl)pyrazol-4-yl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cnn(-c2ccccc2[N+](=O)[O-])c1)OCc1ccccc1 |
| InChI | InChI=1S/C21H18N4O4/c26-21(29-16-17-8-2-1-3-9-17)22-13-7-6-10-18-14-23-24(15-18)19-11-4-5-12-20(19)25(27)28/h1-5,8-9,11-12,14-15H,7,13,16H2,(H,22,26) |
| InChIKey | BTYXZTSGQHSGGU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|