C17H16N2O3 — CID 170462020
benzyl N-[4-(5-hydroxy-3-pyridinyl)but-3-ynyl]carbamate (PubChem CID 170462020) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is benzyl N-[4-(5-hydroxy-3-pyridinyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(5-hydroxy-3-pyridinyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462020 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | benzyl N-[4-(5-hydroxy-3-pyridinyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cncc(O)c1)OCc1ccccc1 |
| InChI | InChI=1S/C17H16N2O3/c20-16-10-15(11-18-12-16)8-4-5-9-19-17(21)22-13-14-6-2-1-3-7-14/h1-3,6-7,10-12,20H,5,9,13H2,(H,19,21) |
| InChIKey | IPLWZFHJVVWTLK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|