C19H19NO4 — CID 170462388
benzyl N-[4-(3-hydroxy-4-methoxyphenyl)but-3-ynyl]carbamate (PubChem CID 170462388) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is benzyl N-[4-(3-hydroxy-4-methoxyphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(3-hydroxy-4-methoxyphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462388 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | benzyl N-[4-(3-hydroxy-4-methoxyphenyl)but-3-ynyl]carbamate |
| SMILES | COc1ccc(C#CCCNC(=O)OCc2ccccc2)cc1O |
| InChI | InChI=1S/C19H19NO4/c1-23-18-11-10-15(13-17(18)21)7-5-6-12-20-19(22)24-14-16-8-3-2-4-9-16/h2-4,8-11,13,21H,6,12,14H2,1H3,(H,20,22) |
| InChIKey | KHNSLGAFDRHZRW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|