C18H18N2O4S — CID 170462947
benzyl N-[4-(3-sulfamoylphenyl)but-3-ynyl]carbamate (PubChem CID 170462947) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is benzyl N-[4-(3-sulfamoylphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(3-sulfamoylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462947 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | benzyl N-[4-(3-sulfamoylphenyl)but-3-ynyl]carbamate |
| SMILES | NS(=O)(=O)c1cccc(C#CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H18N2O4S/c19-25(22,23)17-11-6-10-15(13-17)7-4-5-12-20-18(21)24-14-16-8-2-1-3-9-16/h1-3,6,8-11,13H,5,12,14H2,(H,20,21)(H2,19,22,23) |
| InChIKey | CGTOMQDOPCLJJY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|