C18H17FN2O4S — CID 170463203
benzyl N-[4-(2-fluoro-4-sulfamoylphenyl)but-3-ynyl]carbamate (PubChem CID 170463203) has the molecular formula C18H17FN2O4S and a molecular weight of 376.41 g/mol. Its IUPAC name is benzyl N-[4-(2-fluoro-4-sulfamoylphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(2-fluoro-4-sulfamoylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463203 |
| Molecular Formula | C18H17FN2O4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | benzyl N-[4-(2-fluoro-4-sulfamoylphenyl)but-3-ynyl]carbamate |
| SMILES | NS(=O)(=O)c1ccc(C#CCCNC(=O)OCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C18H17FN2O4S/c19-17-12-16(26(20,23)24)10-9-15(17)8-4-5-11-21-18(22)25-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,12H,5,11,13H2,(H,21,22)(H2,20,23,24) |
| InChIKey | PLJGGSUKPIMJIH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|