C18H16F2N2O2 — CID 170462598
benzyl N-[4-(4-amino-2,5-difluorophenyl)but-3-ynyl]carbamate (PubChem CID 170462598) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is benzyl N-[4-(4-amino-2,5-difluorophenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(4-amino-2,5-difluorophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462598 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | benzyl N-[4-(4-amino-2,5-difluorophenyl)but-3-ynyl]carbamate |
| SMILES | Nc1cc(F)c(C#CCCNC(=O)OCc2ccccc2)cc1F |
| InChI | InChI=1S/C18H16F2N2O2/c19-15-11-17(21)16(20)10-14(15)8-4-5-9-22-18(23)24-12-13-6-2-1-3-7-13/h1-3,6-7,10-11H,5,9,12,21H2,(H,22,23) |
| InChIKey | SZHMLMQPMGORAU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|