C19H18BrNO2 — CID 170463586
benzyl N-[4-(4-bromo-2-methylphenyl)but-3-ynyl]carbamate (PubChem CID 170463586) has the molecular formula C19H18BrNO2 and a molecular weight of 372.26 g/mol. Its IUPAC name is benzyl N-[4-(4-bromo-2-methylphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(4-bromo-2-methylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463586 |
| Molecular Formula | C19H18BrNO2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | benzyl N-[4-(4-bromo-2-methylphenyl)but-3-ynyl]carbamate |
| SMILES | Cc1cc(Br)ccc1C#CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18BrNO2/c1-15-13-18(20)11-10-17(15)9-5-6-12-21-19(22)23-14-16-7-3-2-4-8-16/h2-4,7-8,10-11,13H,6,12,14H2,1H3,(H,21,22) |
| InChIKey | VCPVHKRRIFTNCA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|