C19H19NO3 — CID 170462144
benzyl N-[4-(2-hydroxy-3-methylphenyl)but-3-ynyl]carbamate (PubChem CID 170462144) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is benzyl N-[4-(2-hydroxy-3-methylphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(2-hydroxy-3-methylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462144 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | benzyl N-[4-(2-hydroxy-3-methylphenyl)but-3-ynyl]carbamate |
| SMILES | Cc1cccc(C#CCCNC(=O)OCc2ccccc2)c1O |
| InChI | InChI=1S/C19H19NO3/c1-15-8-7-12-17(18(15)21)11-5-6-13-20-19(22)23-14-16-9-3-2-4-10-16/h2-4,7-10,12,21H,6,13-14H2,1H3,(H,20,22) |
| InChIKey | ODUAIFDTPZFARQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|