C20H18N2O2 — CID 170462581
benzyl N-[4-(2-cyano-5-methylphenyl)but-3-ynyl]carbamate (PubChem CID 170462581) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is benzyl N-[4-(2-cyano-5-methylphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(2-cyano-5-methylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462581 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | benzyl N-[4-(2-cyano-5-methylphenyl)but-3-ynyl]carbamate |
| SMILES | Cc1ccc(C#N)c(C#CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H18N2O2/c1-16-10-11-19(14-21)18(13-16)9-5-6-12-22-20(23)24-15-17-7-3-2-4-8-17/h2-4,7-8,10-11,13H,6,12,15H2,1H3,(H,22,23) |
| InChIKey | NUUZWSYKCJSENB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|