C19H15FN2O2 — CID 170462544
benzyl N-[4-(4-cyano-2-fluorophenyl)but-3-ynyl]carbamate (PubChem CID 170462544) has the molecular formula C19H15FN2O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is benzyl N-[4-(4-cyano-2-fluorophenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(4-cyano-2-fluorophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462544 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | benzyl N-[4-(4-cyano-2-fluorophenyl)but-3-ynyl]carbamate |
| SMILES | N#Cc1ccc(C#CCCNC(=O)OCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C19H15FN2O2/c20-18-12-16(13-21)9-10-17(18)8-4-5-11-22-19(23)24-14-15-6-2-1-3-7-15/h1-3,6-7,9-10,12H,5,11,14H2,(H,22,23) |
| InChIKey | BHJKWCSSONYENH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|